| Identification |
| Name: | Benzeneacetic acid,1-methylethyl ester |
| Synonyms: | Aceticacid, phenyl-, isopropyl ester (6CI,7CI,8CI);Isopropyl benzeneacetate;Isopropyl phenylacetate;propan-2-yl phenylacetate;Benzeneacetic acid 1-methylethyl ester;1-Methylethyl phenylacetate; |
| CAS: | 4861-85-2 |
| EINECS: | 225-468-5 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-9(2)13-11(12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 95 C |
| Boiling Point: | 252 - 254 C |
| Density: | 252 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Refractive index: | n20/D 1.488(lit.) |
| Water Solubility: | negligible Stability Stable. Incompatible with strong oxidizing agents.Combustible. Toxicology Non-hazardous according to Directive 67/548/EEC. Toxicity data (Th |
| Solubility: | negligible |
| Appearance: | colourless to pale yellow liquid |
| Flash Point: | 95 C |
| Safety Data |
| |
 |
