| Identification | |
| Name: | 3-Chlorothioanisole |
| Synonyms: | Sulfide,m-chlorophenyl methyl (6CI,7CI,8CI);3-(Methylthio)-1-chlorobenzene;3-Chlorophenyl methyl sulfide;Methyl 3-chlorophenylsulfide;Methyl m-chlorophenyl sulfide;NSC 133796;m-Chlorophenyl methylsulfide;m-Chlorothioanisole; |
| CAS: | 4867-37-2 |
| EINECS: | -0 |
| Molecular Formula: | C7H7ClS |
| Molecular Weight: | 158.64 |
| InChI: | InChI=1S/C7H7ClS/c1-9-7-4-2-3-6(8)5-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3334 |
| Density: | 1.2 g/cm3 |
| Refractive index: | 1.600 |
| Specification: |
3-Chlorothioanisole , with CAS number of 4867-37-2, can be called 3-Cpms ; benzene, 1-chloro-3-(methylthio)- ; 1-Chloro-3-(methylsulfanyl)benzene . |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
