| Identification | |
| Name: | Pyridine,3-(1-methyl-1H-pyrrol-2-yl)- |
| Synonyms: | Nicotyrine(6CI,7CI); Pyridine, 3-(1-methylpyrrol-2-yl)- (8CI);1-Methyl-2-(3-pyridyl)pyrrole; 3,2'-Nicotyrine; 3-(1-Methyl-2-pyrrolyl)pyridine;NSC 127943; NSC 407276; b-Nicotyrine |
| CAS: | 487-19-4 |
| EINECS: | 207-651-1 |
| Molecular Formula: | C10H10 N2 |
| Molecular Weight: | 158.22 |
| InChI: | InChI=1/C10H10N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2-8H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 124.8°C |
| Boiling Point: | 282.8°Cat760mmHg |
| Density: | 1.04g/cm3 |
| Stability: | Light, Air Sensitive |
| Refractive index: | 1.581 |
| Specification: |
beta-Nicotyrine ,its cas register number is 487-19-4. It also can be called alpha-Nicotyrine ; Pyridine, 3- (1-methylpyrrol-2-yl)- and Pyridine, 3- (1-methyl-1H-pyrrol-2-yl)- . beta-Nicotyrine (CAS NO.487-19-4) is an alkaloid derived from the dehydrogenation of nicotine. |
| Flash Point: | 124.8°C |
| Usage: | Nicotryrine is an alkaloid derived from the dehydrogenation of nicotine and its analog, nornicotine |
| Safety Data | |
 |
|
