| Identification | |
| Name: | 4H-1-Benzopyran-4-one,2,3-dihydro-2-phenyl- |
| Synonyms: | 2,3-Dihydro-2-phenyl-4H-1-benzopyran-4-one;2-Phenyl-3,4-dihydro-2H-benzopyran-4-one;2-Phenyl-3,4-dihydrobenzopyran-4-one;2-Phenyl-4-chromanone;4-Flavanone; |
| CAS: | 487-26-3 |
| EINECS: | 207-654-8 |
| Molecular Formula: | C15H12O2 |
| Molecular Weight: | 224.25 |
| InChI: | InChI=1/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.192 g/cm3 3 |
| Refractive index: | 1.603 |
| Appearance: | Very slightly yellow powder |
| Specification: | VERY SLIGHTLY YELLOW POWDER usageEng:Propafenone (P757500) impurity. Safety Statements:36/37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Report: |
Reported in EPA TSCA Inventory. |
| Usage: | Propafenone (P757500) impurity. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
