| Identification | |
| Name: | Indole-3-carboxaldehyde |
| Synonyms: | 3-Indolecarboxaldehyde;.beta.-Indolylaldehyde;5-21-08-00246 (Beilstein Handbook Reference);1H-Indole-3-carboxaldehyde;beta-Indolylaldehyde;3-Indolealdehyde;246045-99-8;3-Formylindole;1H-indole-3-carbaldehyde;3-Indolecarbaldehyde; |
| CAS: | 487-89-8 |
| EINECS: | 207-665-8 |
| Molecular Formula: | C9H7NO |
| Molecular Weight: | 145.16 |
| InChI: | InChI=1/C9H7NO/c11-6-7-5-10-9-4-2-1-3-8(7)9/h1-6,10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.278 g/cm3 |
| Stability: | Has not been fully evaluated. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white to off-white crystals |
| Specification: |
? 3-Formylindole (CAS No.487-89-8), it also can be called Indol-3-carboxaldehyde ; Indole-3-aldehyde ; beta-Indolylaldehyde ; 1H-Indole-3-carboxaldehyde . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29339990 |
| Storage Temperature: | Keep Cold |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
