| Identification | |
| Name: | 1H-Indol-5-ol,3-[2-(dimethylamino)ethyl]- |
| Synonyms: | Bufotenine(6CI); Indol-5-ol, 3-[2-(dimethylamino)ethyl]- (7CI,8CI);3-(2-Dimethylaminoethyl)indol-5-ol; 3-(b-Dimethylaminoethyl)-5-hydroxyindole;5-Hydroxy-N,N-dimethyltryptamine; Bufotenin; Cinobufotenine; Dimethylserotonin;Mappin; Mappine; N,N-Dimethyl-5-hydroxytryptamine; N,N-Dimethylserotonin; NSC89593 |
| CAS: | 487-93-4 |
| EINECS: | 207-667-9 |
| Molecular Formula: | C12H16 N2 O |
| Molecular Weight: | 204.30 |
| InChI: | InChI=1/C12H16N2O/c1-14(2)6-5-9-8-13-12-4-3-10(15)7-11(9)12/h3-4,7-8,13,15H,5-6H2,1-2H3 |
| Molecular Structure: | ![(C12H16N2O) Bufotenine(6CI); Indol-5-ol, 3-[2-(dimethylamino)ethyl]- (7CI,8CI);3-(2-Dimethylaminoethyl)indol-5-o...](https://img1.guidechem.com/chem/e/dict/23/487-93-4.jpg) |
| Properties | |
| Transport: | 1544 |
| Flash Point: | 191.3°C |
| Boiling Point: | 392.8°C at 760 mmHg |
| Density: | 1.178g/cm3 |
| Refractive index: | 1.646 |
| Specification: |
3-(2-Dimethylaminoethyl)-5-Indolol (CAS NO.487-93-4) is a tryptamine related to the neurotransmitter serotonin. It is an alkaloid found in the skin of some species of toads; in mushrooms, higher plants, and mammals. |
| Packinggroup: | III |
| Flash Point: | 191.3°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: | Controlled substance (hallucinogen). |
| Safety Data | |
 |
|
