| Identification | |
| Name: | 3-methylpyrocatechol |
| Synonyms: | Pyrocatechol,3-methyl- (6CI,8CI); 1,2-Dihydroxy-3-methylbenzene; 2,3-Dihydroxytoluene;2,3-Toluenediol; 2-Hydroxy-3-methylphenol; 2-Hydroxy-6-methylphenol;3-Methyl-1,2-benzenediol; 3-Methyl-1,2-dihydroxybenzene; 3-Methylcatechol;3-Methylpyrocatechol; NSC 66523 |
| CAS: | 488-17-5 |
| EINECS: | 207-672-6 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c1-5-3-2-4-6(8)7(5)9/h2-4,8-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.21g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.594 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Tan crystalline powder crystalline powder. |
| Specification: |
2,3-Dihydroxytoluene (488-17-5) is a brown-grey crystalline powder and soluble in water. It is mainly is used as a novel enzyme inhibitor agent. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A novel enzyme inhibitor agent |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
