| Identification | |
| Name: | 1,2,3,4-Tetramethylbenzene |
| Synonyms: | Prehenitene; 1,2,3,4-tetramethyl-benze |
| CAS: | 488-23-3 |
| EINECS: | 207-673-1 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.22 |
| InChI: | InChI=1/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 4 |
| Density: | 0.9 |
| Refractive index: | 1.5190 |
| Specification: |
1,2,3,4-Tetramethylbenzene , its cas register number is 488-23-3. It also can be called Prehnitene ; and Benzene, 1,2,3,4-tetramethyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
F: Flammable
|
 |
|
