| Identification | |
| Name: | 4-Cyclopentene-1,2,3-trione,4,5-dihydroxy- |
| Synonyms: | Croconicacid (6CI); 4,5-Dihydroxy-4-cyclopentene-1,2,3-trione |
| CAS: | 488-86-8 |
| Molecular Formula: | C5H2 O5 |
| Molecular Weight: | 142.06638 |
| InChI: | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h1,6H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 144.4°C |
| Boiling Point: | 291.7°Cat760mmHg |
| Density: | 2.311g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.619 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive 67/548/EEC. Toxicity data (The meaning of any toxic |
| Solubility: |
|
| Appearance: | gold-coloured powder |
| Specification: |
Croconic acid (CAS NO.488-86-8) is also called 4,5-Dihydroxy-4-cyclopentene-1,2,3-trione ; 4,5-Dihydroxy-cyclopent-4-ene-1,2,3-trione ; 1,2-Dihydroxy-3,4,5-trioxocyclopent-1-ene ; 1,2-dihydroxycyclopentene-3,4,5-trione ; crocic acid . Croconic acid (CAS NO.488-86-8) is gold-coloured powder. It is sensitive to light, soluble in water and ethanol and forms yellow crystals that decompose at 212 °C. |
| Flash Point: | 144.4°C |
| Safety Data | |
 |
|
