| Identification | |
| Name: | 3-Furoic acid |
| Synonyms: | 3-Furoicacid (8CI);3-Carboxyfuran;3-Furanoic acid;NSC 349941; |
| CAS: | 488-93-7 |
| EINECS: | 207-689-9 |
| Molecular Formula: | C5H4O3 |
| Molecular Weight: | 112.08 |
| InChI: | InChI=1/C5H4O3/c6-5(7)4-1-2-8-3-4/h1-3H,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.322 g/cm3 |
| Stability: | No data. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
?3-Furoic acid , its cas register number is 488-93-7. It also can be called?3-Furancarboxylic acid ; 3-Furancarboxylic acid (9CI) ;?3-Carboxyfuran; 3-Furanoic acid ; Furan-3-carboxylic acid .It is a?white to light yellow crystal powder. |
| HS Code: | 29321900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
