| Identification | |
| Name: | Azulene,1,4-dimethyl-7-(1-methylethyl)- |
| Synonyms: | Azulene,7-isopropyl-1,4-dimethyl- (8CI); 1,4-Dimethyl-7-(1-methylethyl)Azulene;1,4-Dimethyl-7-isopropylazulene; 3,8-Dimethyl-5-(2-propyl)azulene;7-Isopropyl-1,4-dimethylazulene; AZ 8; AZ 8 Beris; Azulen-Beris; Azulon;Azunol; Cuteazul; Eucazulen; Guaiazulene; Guaiazulene blue; Kessazulen; NSC4714; Purazulen; S-Guaiazulene; Silazulon; Uroazulen; Vaumigan; Vetivazulen |
| CAS: | 489-84-9 |
| EINECS: | 207-701-2 |
| Molecular Formula: | C15H18 |
| Molecular Weight: | 198.3 |
| InChI: | InChI=1/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Density: | 0.976 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4985 (25 C) |
| Solubility: | Insoluble |
| Appearance: | dark blue semi-solid |
| Specification: | DARK BLUE LOW MELTING CRYSTALLINE SOLID Safety Statements:36/37/39-26-22-36 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
