Identification |
Name: | Benzoic acid,2-mercapto-, methyl ester |
Synonyms: | Benzoicacid, o-mercapto-, methyl ester (6CI,7CI,8CI);2-(Methoxycarbonyl)benzenethiol;2-(Methoxycarbonyl)thiophenol;2-Mercaptobenzoic acid methyl ester;Methyl2-mercaptobenzoate;Methyl 2-sulfanylbenzoate;Methyl 2-thiosalicylate;Methylo-mercaptobenzoate;Methyl thiosalicylate;NSC 30156;Thiosalicylic acid methylester; |
CAS: | 4892-02-8 |
Molecular Formula: | C8H8O2S |
Molecular Weight: | 168.21 |
InChI: | InChI=1/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,11H,1H3 |
Molecular Structure: |
|
Properties |
Density: | 1.223 |
Refractive index: | 1.591 |
Appearance: | Light blue liquid |
Specification: | clear colorless to light yellow or light green Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|