| Identification | |
| Name: | Benzoic acid,2-mercapto-, methyl ester |
| Synonyms: | Benzoicacid, o-mercapto-, methyl ester (6CI,7CI,8CI);2-(Methoxycarbonyl)benzenethiol;2-(Methoxycarbonyl)thiophenol;2-Mercaptobenzoic acid methyl ester;Methyl2-mercaptobenzoate;Methyl 2-sulfanylbenzoate;Methyl 2-thiosalicylate;Methylo-mercaptobenzoate;Methyl thiosalicylate;NSC 30156;Thiosalicylic acid methylester; |
| CAS: | 4892-02-8 |
| Molecular Formula: | C8H8O2S |
| Molecular Weight: | 168.21 |
| InChI: | InChI=1/C8H8O2S/c1-10-8(9)6-4-2-3-5-7(6)11/h2-5,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.223 |
| Refractive index: | 1.591 |
| Appearance: | Light blue liquid |
| Specification: | clear colorless to light yellow or light green Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
