| Identification | |
| Name: | Methyl 4-bromobutyrate |
| Synonyms: | Butyricacid, 4-bromo-, methyl ester (6CI,7CI,8CI);4-Bromobutanoic acid methyl ester;4-Bromobutyric acid methyl ester;Methyl 4-bromobutanoate;Methyl g-bromobutyrate;Methyl w-bromobutyrate; |
| CAS: | 4897-84-1 |
| EINECS: | 225-523-3 |
| Molecular Formula: | C5H9BrO2 |
| Molecular Weight: | 181.03 |
| InChI: | InChI=1/C5H9BrO2/c1-8-5(7)3-2-4-6/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.434 |
| Refractive index: | 1.4620 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Clear colorless to pale yellow liquid |
| Specification: |
Methyl 4-bromobutyrate , its CAS NO. is 4897-84-1, the synonym is 4-Bromobutyric acid methyl ester . |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
