| Identification | |
| Name: | Pyrazinol,6-(1-methylpropyl)-3-(2-methylpropyl)-, 1-oxide, (+)- |
| Synonyms: | Aspergillicacid (6CI,7CI,8CI) |
| CAS: | 490-02-8 |
| Molecular Formula: | C12H20 N2 O2 |
| Molecular Weight: | 224.34 |
| InChI: | InChI=1/C12H20N2O2/c1-5-9(4)11-7-13-10(6-8(2)3)12(15)14(11)16/h7-9,16H,5-6H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 157.2°C |
| Boiling Point: | 336.3°Cat760mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.532 |
| Specification: |
Aspergillic acid (CAS NO.490-02-8) is high toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Aspergillic acid (CAS NO.490-02-8) separate from food materials of the storeroom. |
| Flash Point: | 157.2°C |
| Safety Data | |
 |
|
