| Identification | |
| Name: | 3,4-Pyridinedicarboxylic acid |
| Synonyms: | cinchomeronic acid crystalline; Pyridine-3,4-dicarboxylic acid; Cinchomeronic acid; 3,4-pyridine dicarboxylic acid |
| CAS: | 490-11-9 |
| EINECS: | 207-705-4 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-6(10)4-1-2-8-3-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.551 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
Removal in wastewater treatment of Pyridine-3,4-dicarboxylic acid (CAS No.490-11-9) can be stated as follows: |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
