| Identification | |
| Name: | Ethanone,1-(2,5-dihydroxyphenyl)- |
| Synonyms: | 3,5-Dihydroxy acetophenone;2,5-dihydroxyacetophenone;Acetophenone,2',5'-dihydroxy- (7CI,8CI);1-(2,5-Dihydroxyphenyl)ethanone;1-Acetyl-2,5-dihydroxybenzene;2,5-Dihydroxy-1-acetylbenzene;2-Acetyl-1,4-benzenediol;2-Acetylhydroquinone;NSC 3759;Quinacetophenone; |
| CAS: | 490-78-8 |
| EINECS: | 207-716-4 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c1-5(9)7-4-6(10)2-3-8(7)11/h2-4,10-11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.291 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.595 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | yellow powder. |
| Specification: | yellow to yellow-green crystals or Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
