| Identification | |
| Name: | 2,5-Dihydroxy benzoic acid |
| Synonyms: | Gentisic acid; Hydroquinonecarboxylic acid; 2,5-Dhba; 2,5-dihydroxy-benzoicaci; 2,5-Dioxybenzoic acid; 5-Hydroxysalicylic acid; 5-hydroxy-salicylicaci; 5-hydroxysalicylicacid; acido2,5-diidrossibenzoico; Benzoic acid, 2,5-dihydroxy- |
| CAS: | 490-79-9 |
| EINECS: | 207-718-5 |
| Molecular Formula: | C7H6O4 |
| Molecular Weight: | 154.12 |
| InChI: | InChI=1/C7H6O4/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,8-9H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.559 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | soluble |
| Solubility: | Soluble |
| Appearance: | White to yellow powder |
| Specification: | white to light beige crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | Z01 |
| HS Code: | 29182990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used as a sample matrix in matrix-assisted laser desorption/ionization mass spectrometry. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
