| Identification | |
| Name: | 2,3,4,5-Tetrachlorophenol |
| Synonyms: | 2,3,4,5-tetrachloro-pheno;phenol,2,3,4,5-tetrachloro;2,3,4,5-TETRACHLOROPHENOL;2,3,4,5-TETRACHLOROPHENOL, 1X1ML, MEOH 2 000UG/ML;2,3,4,5-TETRACHLOROPHENOL, 100MG, NEAT;2,3,4,5-tetrachlorophenol solution;2,3,4,5-tetrachlorophenate;2,3,4,5-TECP |
| CAS: | 4901-51-3 |
| EINECS: | 225-531-7 |
| Molecular Formula: | C6H2Cl4O |
| Molecular Weight: | 231.89 |
| InChI: | InChI=1S/C6H2Cl4O/c7-2-1-3(11)5(9)6(10)4(2)8/h1,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1230 3/PG 2 |
| Flash Point: | 4 °C |
| Boiling Point: | 164(3.06kPa) |
| Solubility: | Very soluble in ethanol |
| Specification: |
Its extinguishing agent is mist of water, foam, dry powder, carbon dioxide, sand. |
| Report: |
Chlorophenol compounds are on the Community Right-To-Know List. |
| Flash Point: | 4 °C |
| Storage Temperature: | APPROX 4°C |
| Color: | Needles from petroleum ether (sublimes) |
| Safety Data | |
| Hazard Symbols | |
 |
|
