| Identification | |
| Name: | Luteolin |
| Synonyms: | 3,4,5,7-Tetrahydroxyflavone |
| CAS: | 491-70-3 |
| EINECS: | 207-741-0 |
| Molecular Formula: | C15H10O6 |
| Molecular Weight: | 286.24 |
| InChI: | InChI=1/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.654 g/cm3 |
| Refractive index: | 1.767 |
| Appearance: | yellow crystalline powder |
| Specification: |
?Luteolin , with CAS number of 491-70-3, can be called 3',4',5,7-Tetrahydroxyflavone ; 5,7,3',4'-Tetrahydroxyflavone ; Digitoflavone ; Luteoline ; Salifazide . Luteolin (CAS NO.491-70-3) is often found in leaves, but it is also seen in celery, thyme, dandelion, rinds, barks, clover blossom and ragweed pollen. Luteolin has also been isolated from Salvia tomentosa. Dietary sources include celery, green pepper, thyme, perilla and camomile tea. |
| Color: | yellow |
| Usage: | Hydroxylated flavone derivative with strong anti-oxidant and radical scavenging properties. Suggested to play a role in cancer prevention |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
