| Identification | |
| Name: | b-D-Glucopyranose |
| Synonyms: | Glucopyranose,b-D- (8CI); b-D-Glucose; b-Dextrose; b-Glucose |
| CAS: | 492-61-5 |
| EINECS: | 207-756-2 |
| Molecular Formula: | C6H12 O6 |
| Molecular Weight: | 180.1559 |
| InChI: | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.732 g/cm3 |
| Refractive index: | 1.635 |
| Appearance: | White powder |
| Specification: | White Crystalline Solid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
