| Identification | |
| Name: | Benzeneacetic acid,4-chloro-a-hydroxy- |
| Synonyms: | Mandelicacid, p-chloro- (6CI,7CI,8CI);(4-Chlorophenyl)(hydroxy)acetic acid;(p-Chlorophenyl)hydroxyacetic acid;2-(4-Chlorophenyl)-2-(hydroxy)acetic acid;2-Hydroxy-2-(4-chlorophenyl)aceticacid;4-Chloro-DL-mandelic acid;DL-4-Chloromandelicacid;DL-p-Chloromandelic acid;NSC 31400;NSC 8112;p-Chloromandelic acid;7138-34-3; |
| CAS: | 492-86-4 |
| EINECS: | 207-764-6 |
| Molecular Formula: | C8H7ClO3 |
| Molecular Weight: | 186.59 |
| InChI: | InChI=1/C8H7ClO3/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,10H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 172.4 ºC |
| Boiling Point: | 361.4 ºC at 760 mmHg |
| Density: | 1.468 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 172.4 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
