Identification |
Name: | alpha-Furil |
Synonyms: | 2,2-Furil, 98%; 1,2-Di(2-furyl)ethane-1,2-dione |
CAS: | 492-94-4 |
EINECS: | 207-766-7 |
Molecular Formula: | C10H6O4 |
Molecular Weight: | 190.15 |
InChI: | InChI=1/C10H6O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6H |
Molecular Structure: |
 |
Properties |
Flash Point: | 138.4ºC |
Boiling Point: | 302.7 ºC at 760 mmHg |
Density: | 1.302 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.54 |
Water Solubility: | Slight solubility in water |
Solubility: | Slight solubility in water |
Appearance: | White crystal or powder. Odorless. |
Specification: | YELLOW-BROWN CRYSTALLINE POWDER Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Report: |
Reported in EPA TSCA Inventory.
|
Flash Point: | 138.4ºC |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry area away from incompatible substances. |
Safety Data |
|
 |