Identification |
Name: | 2,2'-Bithiophene |
Synonyms: | 2-thiophen-2-ylthiophene;2,2-Bithiophene;2,2'-Dithiophene; |
CAS: | 492-97-7 |
EINECS: | 207-767-2 |
Molecular Formula: | C8H6S2 |
Molecular Weight: | 166.26 |
InChI: | InChI=1/C8H6S2/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H |
Molecular Structure: |
 |
Properties |
Density: | 1.243 g/cm3 |
Refractive index: | 1.63 |
Appearance: | yellow to green low melting solid |
Specification: | white to light yellow crystal powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Safety Data |
|
 |