| Identification | |
| Name: | 2,2'-Bithiophene |
| Synonyms: | 2-thiophen-2-ylthiophene;2,2-Bithiophene;2,2'-Dithiophene; |
| CAS: | 492-97-7 |
| EINECS: | 207-767-2 |
| Molecular Formula: | C8H6S2 |
| Molecular Weight: | 166.26 |
| InChI: | InChI=1/C8H6S2/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.243 g/cm3 |
| Refractive index: | 1.63 |
| Appearance: | yellow to green low melting solid |
| Specification: | white to light yellow crystal powder Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
 |
|
