Identification |
Name: | 1,2-Cyclohexanedione, 1,2-dioxime |
Synonyms: | 1,2-Cyclohexanedione,dioxime (6CI,7CI,8CI,9CI);1,2-Bis(hydroxyimino)cyclohexane;NSC 4076;Nioxim;Nioxime;Nyoxime;1,2-Cyclohexanedione dioxime; |
CAS: | 492-99-9 |
EINECS: | 207-769-3 |
Molecular Formula: | C6H10N2O2 |
Molecular Weight: | 142.15 |
InChI: | InChI=1/C6H10N2O2/c9-7-5-3-1-2-4-6(5)8-10/h9-10H,1-4H2/b7-5+,8-6+ |
Molecular Structure: |
 |
Properties |
Density: | 1.36 g/cm3 |
Refractive index: | 1.594 |
Appearance: | beige brown crystalline powder |
Specification: | beige to brown crystalline powder or needles Safety Statements:22-24/25-36-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice |
Storage Temperature: | 2-8°C |
Safety Data |
|
 |