| Identification | |
| Name: | Aniline, N,N-diethyl-p-((p-ethylphenyl)azo)- |
| Synonyms: | 4-(Diethylamino)-4'-ethylazobenzene;N,N-Diethyl-4-[(4-ethylphenyl)azo]aniline |
| CAS: | 4928-41-0 |
| Molecular Formula: | C18H23N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C18H23N3/c1-4-15-7-9-16(10-8-15)19-20-17-11-13-18(14-12-17)21(5-2)6-3/h7-14H,4-6H2,1-3H3/b20-19+ |
| Molecular Structure: | ![(C18H23N3) 4-(Diethylamino)-4'-ethylazobenzene;N,N-Diethyl-4-[(4-ethylphenyl)azo]aniline](https://img.guidechem.com/crawlimg/4928-41-0.png) |
| Properties | |
| Flash Point: | 212.6°C |
| Boiling Point: | 427.9°C at 760 mmHg |
| Density: | 0.99g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
Aniline, N,N-diethyl-p-((p-ethylphenyl)azo)- (CAS NO.4928-41-0) can be called 4'-Ethyl-N,N-diethyl-4-aminoazobenzene ; 4-Diethylamino-4'-ethylazobenzene and so on. |
| Flash Point: | 212.6°C |
| Safety Data | |
 |
|
