| Identification | |
| Name: | 1H-1,2,4-Triazole-3-carboxylic acid |
| Synonyms: | 1,2,4-Triazole-3-carboxylic acid;4H-1,2,4-Triazole-3-carboxylic acid;NSC165527;NSC 202574; |
| CAS: | 4928-87-4 |
| Molecular Formula: | C3H3N3O2 |
| Molecular Weight: | 113.07 |
| InChI: | InChI=1/C3H3N3O2/c7-3(8)2-4-1-5-6-2/h1H,(H,7,8)(H,4,5,6)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.694 g/cm3 |
| Appearance: | Yellowish crystalline powder |
| Specification: |
1H-1,2,4-Triazole-3-carboxylic acid , its cas register number is 4928-87-4. It also can be called 1H-1,2,4-triazole-5-carboxylic acid ; and 4H-1,2,4-Triazole-3-carboxylic acid . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
