| Identification | |
| Name: | 1H-1,2,4-Triazole-5-carboxylicacid, methyl ester |
| Synonyms: | 1H-1,2,4-Triazole-3-carboxylicacid, methyl ester (9CI);s-Triazole-3-carboxylic acid, methyl ester (7CI,8CI);3-Methoxycarbonyl-1,2,4-triazole;Methyl1H-1,2,4-triazole-3-carboxylate; |
| CAS: | 4928-88-5 |
| EINECS: | 480-470-5 |
| Molecular Formula: | C4H5N3O2 |
| Molecular Weight: | 127.1 |
| InChI: | InChI=1/C4H5N3O2/c1-9-4(8)3-5-2-6-7-3/h2H,1H3,(H,5,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38 g/cm3 |
| Refractive index: | 1.534 |
| Appearance: | white crystalline powder |
| Specification: |
1H-1,2,4-Triazole-5-carboxylicacid, methyl ester , its cas register number is 4928-88-5. It also can be called Methyl 1,2,4-triazole-3-carboxylate ; and 1H-1,2,4-Triazole-3-carboxylic acid methyl ester . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
