| Identification | |
| Name: | cis-Decahydronaphthalene |
| Synonyms: | cis-bicyclo(4.4.0)decane; cis-decaline |
| CAS: | 493-01-6 |
| EINECS: | 207-770-9 |
| Molecular Formula: | C10H18 |
| Molecular Weight: | 138.25 |
| InChI: | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1147 3/PG 3 |
| Melting Point: | −43 °C(lit.) |
| Flash Point: | 57.2°C |
| Density: | 0.89 |
| Stability: | Stable. Incompatible with oxidizing agents. May form explosive peroxides. Heat and light accelerate peroxide formation. |
| Refractive index: | n20/D 1.481(lit.) |
| Solubility: | Very sol in alcohol, methanol, ether, chloroform. Miscible with propyl and isopropyl alcohol; miscible with most ketones and esters. In water, 0.889 mg/l @ 25 deg C |
| Appearance: | colourless liquid |
| Packinggroup: | III |
| Flash Point: | 57.2°C |
| Color: | Clear colorless liquid Water-white liquid |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
