| Identification | |
| Name: | Naphthalene,decahydro-, trans- |
| Synonyms: | t-decalin;trans-Bicyclo[4.4.0]decane; trans-Decahydronaphthalene; trans-Decalin;trans-Perhydronaphthalene |
| CAS: | 493-02-7 |
| EINECS: | 207-771-4 |
| Molecular Formula: | C10H18 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10- |
| Molecular Structure: | ![(C10H18) t-decalin;trans-Bicyclo[4.4.0]decane; trans-Decahydronaphthalene; trans-Decalin;trans-Perhydronaphth...](https://img1.guidechem.com/chem/e/dict/159/493-02-7.jpg) |
| Properties | |
| Transport: | UN 1147 3/PG 3 |
| Melting Point: | -32 C |
| Flash Point: | 57.2°C |
| Boiling Point: | 190.9°Cat760mmHg |
| Density: | 0.872g/cm3 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. May form explosive peroxides in storage. |
| Refractive index: | n20/D 1.469(lit.) |
| Solubility: | |
| Appearance: | liquid |
| Specification: | liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 57.2°C |
| Color: | Clear colorless liquid Water-white liquid |
| Safety Data | |
 |
|
