| Identification | |
| Name: | Isochroman |
| Synonyms: | Isochroman(6CI,7CI,8CI);NSC 63362;3,4-Dihydro-1H-2-Benzopyran; |
| CAS: | 493-05-0 |
| EINECS: | 207-774-0 |
| Molecular Formula: | C9H10O |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C9H10O/c1-2-4-9-7-10-6-5-8(9)3-1/h1-4H,5-7H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 3 |
| Density: | 1.067 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.543-1.546 |
| Solubility: | Slightly soluble |
| Appearance: | clear colorless to yellowish liquid |
| Specification: |
3,4-Dihydro-1H-2-Benzopyran , its cas register number is 493-05-0. It also can be called Isochromane . 3,4-Dihydro-1H-2-Benzopyran (CAS NO.493-05-0) is a clear colorless to yellowish liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
