| Identification | |
| Name: | 4H-1-Benzopyran-2-carboxylicacid, 4-oxo- |
| Synonyms: | 2-Chromonecarboxylic acid;Chromone-2-carboxylic acid;4-Oxo-4H-chromene-2-carboxylic acid;4-Oxochromene-2-carboxylic acid;Atremon;Campel;Chromocarb; |
| CAS: | 4940-39-0 |
| EINECS: | 225-583-0 |
| Molecular Formula: | C10H6O4 |
| Molecular Weight: | 190.15 |
| InChI: | InChI=1/C10H6O4/c11-7-5-9(10(12)13)14-8-4-2-1-3-6(7)8/h1-5H,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.493 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble |
| Appearance: | Light beige powder. |
| Specification: |
4H-1-Benzopyran-2-carboxylicacid, 4-oxo- , its cas register number is 4940-39-0. It also can be called 4-Oxo-4H-1-benzopyran-2-carboxylic acid ; 5-18-08-00312 (Beilstein Handbook Reference) ; Atremon ; Chromocarb ; Chromocarbe ; |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
