| Identification |
| Name: | 1H-Indole-6-carboxylicacid, 2-bromo-3-cyclohexyl-, methyl ester |
| Synonyms: | 2-Bromo-3-cyclohexyl-1H-indole-6-carboxylicacid methyl ester; 2-Bromo-3-cyclohexyl-indole-6-carboxylic acid methyl ester;2-bromo-3-cyclohexyl-1H-indole-6-carboxylic acid methyl ester; Methyl2-bromo-3-cyclohexyl-1H-indole-6-carboxylate; Methyl2-bromo-3-cyclohexyl-6-indolecarboxylate |
| CAS: | 494799-19-8 |
| Molecular Formula: | C16H18 Br N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C16H18BrNO2/c1-20-16(19)11-7-8-12-13(9-11)18-15(17)14(12)10-5-3-2-4-6-10/h7-10,18H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 230.8°C |
| Boiling Point: | 458°C at 760 mmHg |
| Density: | 1.417g/cm3 |
| Refractive index: | 1.625 |
| Flash Point: | 230.8°C |
| Usage: | An indole derivatives as antiviral agents and their use in the treatment of hepatitis C virus infection. |
| Safety Data |
| |
 |
