| Identification | |
| Name: | Pentanoic acid, 3-oxo-,ethyl ester |
| Synonyms: | 3-Oxopentanoic acid ethyl ester;Valericacid, 3-oxo-, ethyl ester (6CI,7CI,8CI);3-Oxovaleric acid ethyl ester;Ethyl 3-ketopentanoate;Ethyl 3-oxopentanoate;Ethyl 3-oxovalerate;Ethyl propanoylacetate;Ethyl propioacetate;Ethyl b-oxovalerate;NSC 7251;NSC 78662;Propionylacetic acid ethyl ester; |
| CAS: | 4949-44-4 |
| EINECS: | 225-593-5 |
| Molecular Formula: | C7H12O3 |
| Molecular Weight: | 144.17 |
| InChI: | InChI=1/C7H12O3/c1-3-6(8)5-7(9)10-4-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.012 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.422-1.424 |
| Water Solubility: | Stability Stable. Combustible. Incompatible withstrong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Toxicity data (The meaning of any toxico |
| Solubility: |
|
| Appearance: | colourless liquid |
| HS Code: | 29183000 |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
