| Identification | |
| Name: | 2-Buten-1-one,1-phenyl- |
| Synonyms: | Crotonophenone(6CI,7CI,8CI); 1-Benzoylpropene; 1-Phenyl-2-buten-1-one; 1-Propenyl phenylketone; 2-Butenophenone; Ethylideneacetophenone; NSC 518668; Phenyl 1-propenylketone; Phenyl propenyl ketone |
| CAS: | 495-41-0 |
| EINECS: | 207-800-0 |
| Molecular Formula: | C10H10 O |
| Molecular Weight: | 146.19 |
| InChI: | InChI=1/C10H10O/c1-2-6-10(11)9-7-4-3-5-8-9/h2-8H,1H3/b6-2+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.99 g/cm3 |
| Refractive index: | 1.53 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
