InChI: | InChI=1/C14H24N6O4/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24) |
Specification: |
The L-Lysine,glycyl-L-histidyl-, with the CAS registry number 49557-75-7, has the systematic name of glycyl-L-histidyl-L-lysine.
The physical properties of this chemical are as follows: (1)ACD/LogP: -2.24; (2)# of Rule of 5 Violations: 2; (3)ACD/LogD (pH 5.5): -6.61; (4)ACD/LogD (pH 7.4): -5.23; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 10; (10)#H bond donors: 8; (11)#Freely Rotating Bonds: 13; (12)Polar Surface Area: 91.22 ; (13)Index of Refraction: 1.582; (14)Molar Refractivity: 85.82 cm3; (15)Molar Volume: 256.9 cm3; (16)Polarizability: 34.02×10-24 cm3; (17)Surface Tension: 67.4 dyne/cm; (18)Density: 1.324 g/cm3; (19)Flash Point: 456.4 °C; (20)Enthalpy of Vaporization: 126.59 kJ/mol; (21)Boiling Point: 831 °C at 760 mmHg; (22)Vapour Pressure: 2.86E-29 mmHg at 25°C.
Additionally, you could obtain the molecular structure by converting the following datas:
(1)SMILES:O=C(O)[C@@H](NC(=O)[C@@H](NC(=O)CN)Cc1cncn1)CCCCN
(2)InChI:InChI=1/C14H24N6O4/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9/h7-8,10-11H,1-6,15-16H2,(H,17,18)(H,19,21)(H,20,22)(H,23,24)/t10-,11-/m0/s1
(3)InChIKey:MVORZMQFXBLMHM-QWRGUYRKBM
|