| Identification | |
| Name: | Indoline |
| Synonyms: | Indoline(6CI,7CI,8CI);1-Azaindan;1H-Indoline;2,3-Dihydro-1H-indole;2,3-Dihydroindole;1H-Indole,2,3-dihydro-; |
| CAS: | 496-15-1 |
| EINECS: | 207-816-8 |
| Molecular Formula: | C8H9N |
| Molecular Weight: | 119.16 |
| InChI: | InChI=1/C8H9N/c1-2-4-8-7(3-1)5-6-9-8/h1-4,9H,5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.063 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.592-1.594 |
| Solubility: | 5 g/L (20 oC) in water |
| Appearance: | clear to yellow liquid |
| Specification: |
? Indoline (CAS NO.496-15-1), its Synonyms are 1-Azaindan ; 2,3-Dihydro-1H-indole ; 2,3-Dihydroindole ; 1H-Indole, 2,3-dihydro- . Indoline is an aromatic heterocyclic organic compound. It has a bicyclic structure, consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing ring. The compound is based on the indole structure, but the 2-3 bond is saturated. It is clear colorless to slightly brown liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29339990 |
| Sensitive: | Light Sensitive |
| Color: | clear dark brown |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
