| Identification | |
| Name: | 2,3-Dihydrobenzofuran |
| Synonyms: | Benzofuran,1,2-dihydro- (3CI);2,3-Dihydro-1-benzofuran;2,3-Dihydrobenzo[b]furan;Benzofuran,2,3-dihydro-;Benzodihydrofuran;Coumaran;Dihydrobenzofuran;Kumaran; |
| CAS: | 496-16-2 |
| EINECS: | 207-817-3 |
| Molecular Formula: | C8H8O |
| Molecular Weight: | 120.15 |
| InChI: | InChI=1/C8H8O/c1-2-4-8-7(3-1)5-6-9-8/h1-4H,5-6H2 |
| Molecular Structure: | ![(C8H8O) Benzofuran,1,2-dihydro- (3CI);2,3-Dihydro-1-benzofuran;2,3-Dihydrobenzo[b]furan;Benzofuran,2,3-dihyd...](https://img.guidechem.com/casimg/496-16-2.gif) |
| Properties | |
| Density: | 1.065 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.549 |
| Solubility: | Slightly soluble |
| Appearance: | colorless to light yellow liquid |
| Specification: |
?2,3-Dihydrobenzofuran (CAS NO.496-16-2) is also named as Coumaran ; Benzofuran, 2,3-dihydro-?; 2,3-Dihydro-1-benzofuran?; Dihydrocoumarone .?2,3-Dihydrobenzofuran (CAS NO.496-16-2) is colorless to light yellow liquid. |
| HS Code: | 29329995 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
