Identification |
Name: | 3-Pyridinecarboxylicacid, 6-chloro-, ethyl ester |
Synonyms: | 2-Chloropyridine-5-carboxylicacid ethyl ester;6-Chloronicotinic acid ethyl ester;Ethyl 2-chloro-5-pyridinecarboxylate;Ethyl 6-chloro-3-nicotinate;Ethyl 6-chloro-3-pyridinecarboxylate; |
CAS: | 49608-01-7 |
EINECS: | -0 |
Molecular Formula: | C8H8ClNO2 |
Molecular Weight: | 185.61 |
InChI: | InChI=1S/C8H8ClNO2/c1-2-12-8(11)6-3-4-7(9)10-5-6/h3-5H,2H2,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.245 g/cm3 |
Refractive index: | 1.522 |
Appearance: | white crystal powder |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |