| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-chloro-, ethyl ester |
| Synonyms: | 2-Chloropyridine-5-carboxylicacid ethyl ester;6-Chloronicotinic acid ethyl ester;Ethyl 2-chloro-5-pyridinecarboxylate;Ethyl 6-chloro-3-nicotinate;Ethyl 6-chloro-3-pyridinecarboxylate; |
| CAS: | 49608-01-7 |
| EINECS: | -0 |
| Molecular Formula: | C8H8ClNO2 |
| Molecular Weight: | 185.61 |
| InChI: | InChI=1S/C8H8ClNO2/c1-2-12-8(11)6-3-4-7(9)10-5-6/h3-5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.245 g/cm3 |
| Refractive index: | 1.522 |
| Appearance: | white crystal powder |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
