| Identification | |
| Name: | RP106 |
| CAS: | 496864-15-4 |
| Molecular Formula: | C16H17N3O |
| Molecular Weight: | 267.33 |
| InChI: | InChI=1/C17H19N3O/c1-3-4-5-14-15(12-6-8-13(21-2)9-7-12)20-17-16(14)18-10-11-19-17/h6-11H,3-5H2,1-2H3,(H,19,20) |
| Molecular Structure: | ![(C16H17N3O) ALOISINE;ALOISINE RP106;7-N-BUTYL-6-(4-METHOXYPHENYL)[5H]PYRROLO[2,3-B]PYRAZINE;RP106;RP106, 7-n-But...](https://img.guidechem.com/structure/496864-15-4.gif) |
| Properties | |
| Density: | 1.155g/cm3 |
| Refractive index: | 1.613 |
| Storage Temperature: | 2-8°C |
| Usage: | A cell-permeable pyrrolo-pyrazine compound that acts as a potent, selective, reversible, and ATP-competitive inhibitor of Cdk1/cyclin B, Cdk5/p35, and GSK-3 ( IC50 =700nM 1.5 uM, and 920 nM, respectively). |
| Safety Data | |
 |
|
