Identification |
Name: | Phenol,4-(7-butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)- |
Synonyms: | Phenol,4-(7-butyl-4H-pyrrolo[2,3-b]pyrazin-6-yl)- (9CI);7-butyl-6-(4-hydroxyphenyl)-5H-pyrrolo[2,3-b]pyrazine;Aloisine A;4-(7-butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenol;7-n-Butyl-6-(4-hydroxyphenyl)[5H]pyrrolo[2,3-b]pyrazine;phenol, 4-(7-butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)-; |
CAS: | 496864-16-5 |
Molecular Formula: | C16H17N3O |
Molecular Weight: | 267.33 |
InChI: | InChI=1/C16H17N3O/c1-2-3-4-13-14(11-5-7-12(20)8-6-11)19-16-15(13)17-9-10-18-16/h5-10,20H,2-4H2,1H3,(H,18,19) |
Molecular Structure: |
|
Properties |
Density: | 1.227g/cm3 |
Refractive index: | 1.655 |
Usage: | A cell-permeable pyrrolo-pyrazine compound that acts as a potent, selective, reversible, and ATP-competitive inhibitor of cyclin dependent kinases (Cdks: IC50 =150nM, 120 nM, 400 nM and 200 nM for Cdk1/cyclin B, Cdk2/cyclin A, Cdk2/cyclin E, and Cdk5/p25, |
Safety Data |
|
|