| Identification | |
| Name: | Arbutin |
| CAS: | 497-76-7 |
| EINECS: | 207-850-3 |
| Molecular Formula: | C12H16O7 |
| Molecular Weight: | 272.2512 |
| InChI: | InChI=1/C12H16O7/c13-5-8-9(15)10(16)11(17)12(19-8)18-7-3-1-6(14)2-4-7/h1-4,8-17H,5H2/t8-,9+,10+,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.556g/cm3 |
| Stability: | Stable. Hygroscopic - store under dry nitrogen. |
| Refractive index: | 1.65 |
| Alpha: | -64 o (C=3) |
| Solubility: | 50mg/mL in water |
| Appearance: | white powder |
| Specification: |
? Arbutin , with CAS number of 497-76-7, can be called (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-hydroxyphenoxy)oxane-3,4,5-triol ; Arbutoside ; Hydroquinone-O-beta-D-glucopyranoside ; Hydroquinone .beta.-D-glucopyranoside ; p-Hydroxyphenyl beta-D-glucoside ; 4-Hydroxyphenyl-beta-D-glucopyranoside .?Arbutin (CAS NO.497-76-7) should be stored in a cool, dry place with?a tightly closed container.? |
| HS Code: | 29389090 |
| Sensitive: | Hygroscopic |
| Color: | Colorless elongated prisms from moist ethyl acetate White powder (pure synthetic) Needles (water + 1) |
| Safety Data | |
 |
|
