Identification |
Name: | SALMETEROL-D3 (3-HYDROXYMETHYL-D2, ALPHA-D1) |
Synonyms: | SALMETEROL-D3 (3-HYDROXYMETHYL-D2, ALPHA-D1);SALMETEROL-D3;4-Hydroxy-a1-[[[6-(4-phenylbutoxy)hexyl]amino]methyl]-1,3-benzenedimethanol-d3;GR-33343X-d3 |
CAS: | 497063-94-2 |
Molecular Formula: | C25H34D3NO4 |
Molecular Weight: | 418.58 |
InChI: | InChI=1/C25H37NO4/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2/i20D2,25D |
Molecular Structure: |
![(C25H34D3NO4) SALMETEROL-D3 (3-HYDROXYMETHYL-D2, ALPHA-D1);SALMETEROL-D3;4-Hydroxy-a1-[[[6-(4-phenylbutoxy)hexyl]a...](https://img.guidechem.com/structure/497063-94-2.gif) |
Properties |
Melting Point: | 75.5-76.60C |
Flash Point: | 318.496°C |
Boiling Point: | 603.021°C at 760 mmHg |
Density: | 1.12g/cm3 |
Refractive index: | 1.566 |
Flash Point: | 318.496°C |
Usage: | A deuterated ?-Adrenergic agonist. Deuterated structural analog of albuterol. Bronchodilator.
A representative lot is 98% isotopically pure, 94% d3, 6% d2 with no d0 |
Safety Data |
|
 |