| Identification | |
| Name: | Acetovanillone |
| Synonyms: | Acetophenone,4'-hydroxy-3'-methoxy- (8CI);1-(4-Hydroxy-3-methoxyphenyl)ethanone;2-Methoxy-4-acetylphenol;3'-Methoxy-4'-hydroxyacetophenone;4-Acetyl-2-methoxyphenol;4-Acetylguaiacol;4-Hydroxy-3-methoxyphenyl methylketone;4'-Hydroxy-3'-methoxyacetophenone;Acetoguaiacon;Acetoguaiacone;Acetoguaicone;Apocynin;Apocynine; |
| CAS: | 498-02-2 |
| EINECS: | 207-854-5 |
| Molecular Formula: | C9H10O3 |
| Molecular Weight: | 166.18 |
| InChI: | InChI=1/C9H10O3/c1-6(10)7-3-4-8(11)9(5-7)12-2/h3-5,11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.158 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.537 |
| Water Solubility: | soluble in hot water |
| Solubility: | soluble in hot water |
| Appearance: | yellowish to brown powder |
| Specification: |
?Acetovanillone (CAS NO.498-02-2) is also named as 4-Hydroxy-3-methoxyacetophenone ; Apocynin ; Acetovanillone~Apocynin ; 4-Hydroxy-3-methoxybenzoic acid ; 3-Methoxy-4-Hydroxy Acetophenone and so on. It is usually light yellow to yellow solid with faint vanilla odor. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29145000 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | A plant-derived, cartilage-saving drug, might be useful in the treatment of rheumatoid arthritis. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
