| Identification | |
| Name: | Norbornylene |
| Synonyms: | Bicyclo[2.2.1]heptene~Norbornylene; Norbornene,99%; 8,9,10-trinorborn-2-ene; bicyclo(2.2.1)hept-2-ene; Norbornene; Bicyclo[2.2.1]-2-heptene; 2-Norbornene |
| CAS: | 498-66-8 |
| EINECS: | 207-866-0 |
| Molecular Formula: | C7H10 |
| Molecular Weight: | 94.15 |
| InChI: | InChI=1/C7H10/c1-2-7-4-3-6(1)5-7/h1-2,6-7H,3-5H2 |
| Molecular Structure: | ![(C7H10) Bicyclo[2.2.1]heptene~Norbornylene; Norbornene,99%; 8,9,10-trinorborn-2-ene; bicyclo(2.2.1)hept-2-en...](https://img.guidechem.com/casimg/498-66-8.gif) |
| Properties | |
| Transport: | UN 1325 4.1/PG 2 |
| Density: | 0.955 g/cm3 |
| Refractive index: | 1.52 |
| Specification: |
2-Norbornene (498-66-8) is stench white mass, known as Bicyclo(2.2.1)heptene ; 3,6-Endomethylenecyclohexene ; NSC 120425 ; Norbornene ; Norbornylene ; Norcamphene ; Norfenchene ; 8,9,10-Trinorborn-2-ene ; Bicyclo(2.2.1)hept-2-ene . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Carbon monoxide , Carbon dioxide . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
F:Highlyflammable
|
 |
|
