| Identification | |
| Name: | 1,2,5,6-Tetrahydro-3-pyridinecarboxylic acid |
| Synonyms: | Guvacine hydrochloride |
| CAS: | 498-96-4 |
| Molecular Formula: | C6H9NO2 |
| Molecular Weight: | 127.1412 |
| InChI: | InChI=1/C6H9NO2/c8-6(9)5-2-1-3-7-4-5/h2,7H,1,3-4H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 123.6°C |
| Boiling Point: | 280.8°Cat760mmHg |
| Density: | 1.199g/cm3 |
| Refractive index: | 1.517 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Specific GABA uptake inhibitor. IC 50 values are 14, 58, 119 and 1870 mM for hGAT-1, rGAT-2, hGAT-3 and hBGT-1 respectively. |
| Flash Point: | 123.6°C |
| Storage Temperature: | Store at RT |
| Color: | white |
| Safety Data | |
 |
|
