| Identification | |
| Name: | 3,5-Dimethylbenzoic acid |
| Synonyms: | 3,5-Dimethylbenzoic Acid/Mesitylenic acid; Mesitylenic acid |
| CAS: | 499-06-9 |
| EINECS: | 207-876-5 |
| Molecular Formula: | C9H10O2 |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C9H10O2/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 128 |
| Boiling Point: | 278 |
| Density: | 1.211 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Soluble |
| Appearance: | White, crystalline flakes |
| Specification: | white to light yellow crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29163900 |
| Flash Point: | 128 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
