| Identification | |
| Name: | 2,4-Pyridinedicarboxylic acid hydrate |
| Synonyms: | Pyridine-2,4-dicarboxylic acid monohydrate; Lutidinic acid; Pyridine-2,4-dicarboxylic acid |
| CAS: | 499-80-9 |
| EINECS: | 207-892-2 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.1189 |
| InChI: | InChI=1S/C7H5NO4/c9-6(10)4-1-2-8-5(3-4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.551 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | white to off-white crystalline powder |
| Specification: | white to almost white crystalline powder Safety Statements:24/25-26 24/25:Avoid contact with skin and eyes 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
