| Identification | |
| Name: | 3,5-Pyridinedicarboxylic acid |
| CAS: | 499-81-0 |
| EINECS: | 207-893-8 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h1-3H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.551 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble |
| Solubility: | Very soluble |
| Appearance: | white crystal powder |
| Specification: |
3,5-Pyridinedicarboxylic acid (CAS NO.499-81-0) is also named as 5-Carboxynicotinic acid ; AI3-52669 ; Dinicotinic acid ; NSC 6497 ; Pyridine-3,5-dicarboxylic acid . 3,5-Pyridinedicarboxylic acid (CAS NO.499-81-0) is white crystal powder. |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Competitive inhibitor of butyrobetaine hydroxylase.1 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
