| Identification | |
| Name: | 2,6-Pyridinedicarboxylic acid |
| Synonyms: | Dipicolinic acid; Pyridine-2,6-dicarboxylic acid; 2,6-DIPICOLINIC ACID; AKOS 2002; 'DIPICOLINIC ACID'; IFLAB-BB F0451-0137; LABOTEST-BB LT00848023; RARECHEM AL BO 1335; 2.6-pyridine carboxylic acid |
| CAS: | 499-83-2 |
| EINECS: | 207-894-3 |
| Molecular Formula: | C7H5NO4 |
| Molecular Weight: | 167.12 |
| InChI: | InChI=1/C7H5NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.551g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | white crystalline powder |
| Specification: |
?Dipicolinic acid (CAS NO.499-83-2) is also named as 2,6-Dipicolinic acid ; Dipicolinate ; NSC 176?; 2,6-Pyridinedicarboxylic acid?.?Dipicolinic acid (CAS NO.499-83-2) is white crystalline powder. It is?insoluble in ethanol. |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Used to prepare dipicolinato ligated lanthanide1 and transition metal2 complexes. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
