| Identification | |
| Name: | Ethanone,1-(5-amino-2,3-dihydro-1H-indol-1-yl)- |
| Synonyms: | 1H-Indol-5-amine,1-acetyl-2,3-dihydro- (9CI);Indoline, 1-acetyl-5-amino- (7CI,8CI);1-(5-Amino-2,3-dihydroindol-1-yl)ethanone;1-Acetyl-2,3-dihydro-1H-indol-5-amine;1-Acetyl-2,3-dihydroindol-5-amine;1-Acetyl-5-amino-2,3-dihydro-1H-indole;1-Acetyl-5-aminoindoline;1-Acetyl-5-indolinamine;5-Amino-1-acetylindoline;N-Acetyl-5-aminoindoline;NSC 158317; |
| CAS: | 4993-96-8 |
| Molecular Formula: | C10H12N2O |
| Molecular Weight: | 176.2151 |
| InChI: | InChI=1/C10H12N2O/c1-7(13)12-5-4-8-6-9(11)2-3-10(8)12/h2-3,6H,4-5,11H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 180-182 ºC |
| Density: | 1.231 g/cm3 |
| Refractive index: | 1.628 |
| Appearance: | brown powder |
| Specification: |
The CAS register number of 1-Acetyl-5-aminoindoline is 4993-96-8. It also can be called as 1-Acetyl-5-amino-2,3-dihydro-1H-indole and the IUPAC name about this chemical is 1-(5-amino-2,3-dihydroindol-1-yl)ethanone. It belongs to the Indole. Physical properties about 1-Acetyl-5-aminoindoline are: (1)ACD/LogP: 0.48; (2)#H bond acceptors: 3; (3)#H bond donors: 2; (4)#Freely Rotating Bonds: 1; (5)Polar Surface Area: 23.55Å2; (6)Index of Refraction: 1.628; (7)Molar Refractivity: 50.82 cm3; (8)Molar Volume: 143.1 cm3; (9)Polarizability: 20.14x10-24cm3; (10)Surface Tension: 56.3 dyne/cm; (11)Enthalpy of Vaporization: 73.21 kJ/mol; (12)Boiling Point: 469.7 °C at 760 mmHg; (13)Vapour Pressure: 5.38E-09 mmHg at 25°C. Uses of 1-Acetyl-5-aminoindoline: it can be used to produce indolin-5-ylamine. This reaction will need reagent conc. HCl. The yield is about 52%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
